1-Naphthyl b-D-mannopyranoside
1-Naphthyl b-D-mannopyranoside is a valuable compound in biomedicine that is commonly used as a substrate in enzyme-based assays. It is especially used in the pharmaceutical industry to study different enzymes involved in the metabolism of mannose-containing molecules. Additionally, it serves as an important tool for drug discovery and development, aiding in the identification of potential therapeutic targets for treating diseases related to altered mannose metabolism.
| Supplier | BOC Sciences |
|---|---|
| Product # | 84297-22-3 |
| Pricing | Inquire |
| Cas | 84297-22-3 |
| Molecular Weight | 306.31 |
| Molecular Formula | C16H18O6 |
| Canonical SMILES | C1=CC=C2C(=C1)C=CC=C2OC3C(C(C(C(O3)CO)O)O)O |