Diheptyl phthalate
DES and 1-octanol can be blended with B5 palm oil biodiesel to improve the oxygen content and achieve a greener emission of combustion gases. It may also be used as a novel and highly efficient solvent to capture carbon dioxide(CO2) which can be potentially used as a technique to reduce carbon emission.
| Supplier | BOC Sciences |
|---|---|
| Product # | 3648-21-3 |
| Pricing | Inquire |
| Cas | 3648-21-3 |
| Molecular Weight | 362.5 |
| Molecular Formula | C22H34O4C22H34O4 |
| Canonical SMILES | CCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCC |