N4-Benzoyl-2'-deoxy-5'-O-(4,4'-dimethoxytrityl)-2',2'-difluorocytidine
N4-Benzoyl-2'-deoxy-5'-O-(4,4'-dimethoxytrityl)-2',2'-difluorocytidine is an invaluable antiviral compound renowned in the biomedical realm, aiding in studying DNA viruses like herpes simplex virus (HSV) and varicella-zoster virus (VZV). Its efficacy stems from its exceptional chemical composition, which selectively targets viral DNA synthesis, thereby thwarting their proliferation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 142808-43-3 |
| Pricing | Inquire |
| Cas | 142808-43-3 |
| Molecular Weight | 669.67 |
| Molecular Formula | C37H33F2N3O7 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC4C(C(C(O4)N5C=CC(=NC5=O)NC(=O)C6=CC=CC=C6)(F)F)O |