N-α-(9-Fluorenylmethoxycarbonyl)-N-ε-{2-[(t-butoxycarbonyl)amino]benzoyl}-L-lysine
Building block for the preparation of fluorescent labelled peptides. The anthranilic acid attached at the side-chain of lysine is highly sensitive and its fluorescence spectrum does not overlap with those of Trp, Phe, and Tyr.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-005461 |
| Pricing | Inquire |
| Cas | 159322-59-5 |
| Molecular Weight | 587.67 |
| Molecular Formula | C33H37N3O7 |
| Canonical SMILES | CC(C)(C)OC(=O)NC1=CC=CC=C1C(=O)NCCCCC(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |