L-Aspartic acid potassium salt (1:1)
L-Aspartic acid is a non-essential amino acid that plays several roles in the body, including being a component of proteins and a precursor to other amino acids and compounds. Potassium is an essential mineral that contributes to various physiological functions, including muscle contraction, nerve function, and fluid balance. L-Aspartic acid potassium salt is commonly used as a dietary supplement for its potential health benefits, particularly in supporting cardiovascular health and athletic performance.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1115-63-5 |
| Pricing | Inquire |
| Cas | 1115-63-5 |
| Molecular Weight | 171.19 |
| Molecular Formula | C4H6KNO4 |
| Canonical SMILES | C(C(C(=O)[O-])N)C(=O)O.[K+] |