2'-O-Acetyl-3'-deoxy-3-deaza-3'-fluoro-5'-O-toluoyluridine
2'-O-Acetyl-3'-deoxy-3-deaza-3'-fluoro-5'-O-toluoyluridine, an extensively employed potent antiviral agent within the biomedical sector, exhibits remarkable efficacy against a range of viral infections like influenza and herpes. Promising outcomes have been observed in its application to impede viral replication and inhibit viral enzymes, rendering it a highly valuable asset in combating these afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2072145-56-1 |
| Pricing | Inquire |
| Cas | 2072145-56-1 |
| Molecular Weight | 405.4 |
| Molecular Formula | C20H20FNO7 |
| Canonical SMILES | CC1=CC=C(C=C1)C(=O)OCC2C(C(C(O2)N3C=CC(=CC3=O)O)OC(=O)C)F |