tert-Butyl (5-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl)methylcarbamate
tert-Butyl (5-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl)methylcarbamate is a highly intricate and scientifically advanced compound. Its efficacious composition manifests vigorous inhibitory properties, targeting specific enzymes implicated in the pathogenesis of cancer and its metastatic dissemination. Additionally, this exceptional substance exhibits tremendous promise in revolutionizing the landscape of neurodegenerative disorders, offering potential avenues for the discovery and formulation of tailored therapeutic interventions. Embracing this breakthrough compound propagates unprecedented advancements in the realm of biomedicine and pharmaceutical discovery, propelling the pursuit of curative solutions for these multifaceted diseases.
Supplier | BOC Sciences |
---|---|
Product # | 1247726-98-2 |
Pricing | Inquire |
Cas | 1247726-98-2 |
Molecular Weight | 364.24426 |
Molecular Formula | C18H29BN2O5 |
Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=NC=C2CNC(=O)OC(C)(C)C)OC |