(S)-DMT-glycidol-A(Bz)
(S)-DMT-glycidol-A(Bz), a critical element in the creation of potential anticancer drugs, has proven effective by restraining tumor progression and stimulating apoptosis in different cancer cell lines such as those in the breast, lung, and pancreas. Its dynamic efficacy in inhibiting specific enzyme pathways at the core of cancer cell growth and survival establish it as a highly viable candidate for innovative cancer treatment measures with significant potential.
| Supplier | BOC Sciences |
|---|---|
| Product # | 115196-70-8 |
| Pricing | Inquire |
| Cas | 115196-70-8 |
| Molecular Weight | 615.68 |
| Molecular Formula | C36H33N5O5 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC(CN4C=NC5=C(N=CN=C54)NC(=O)C6=CC=CC=C6)O |