APS-5
APS-5 is a chemiluminescent substrate based on 9, 10-dihydroacridine, which is mainly used for ELISA detection of alkaline phosphatase AP conjugated compounds and for the diagnosis of immune detection, such as tumor markers, infectious diseases, endocrine function, hormones, etc.
Supplier | BOC Sciences |
---|---|
Product # | B2708-285642 |
Pricing | 100 mg/unit USD $199 |
Cas | 193884-53-6 |
Molecular Weight | 489.82 |
Molecular Formula | C21H15ClNNa2O4PS |
Canonical SMILES | CN1C2=CC=CC=C2C(=C(OP(=O)([O-])[O-])SC3=CC=C(C=C3)Cl)C4=CC=CC=C41.[Na+].[Na+] |