APS-5

APS-5 is a chemiluminescent substrate based on 9, 10-dihydroacridine, which is mainly used for ELISA detection of alkaline phosphatase AP conjugated compounds and for the diagnosis of immune detection, such as tumor markers, infectious diseases, endocrine function, hormones, etc.
Supplier BOC Sciences
Product # B2708-285642
Pricing Inquire
Cas 193884-53-6
Molecular Weight 489.82
Molecular Formula C21H15ClNNa2O4PS
Canonical SMILES CN1C2=CC=CC=C2C(=C(OP(=O)([O-])[O-])SC3=CC=C(C=C3)Cl)C4=CC=CC=C41.[Na+].[Na+]
Feedback