APS-5
APS-5 is a chemiluminescent substrate based on 9, 10-dihydroacridine, which is mainly used for ELISA detection of alkaline phosphatase AP conjugated compounds and for the diagnosis of immune detection, such as tumor markers, infectious diseases, endocrine function, hormones, etc.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2708-285642 |
| Pricing | Inquire |
| Cas | 193884-53-6 |
| Molecular Weight | 489.82 |
| Molecular Formula | C21H15ClNNa2O4PS |
| Canonical SMILES | CN1C2=CC=CC=C2C(=C(OP(=O)([O-])[O-])SC3=CC=C(C=C3)Cl)C4=CC=CC=C41.[Na+].[Na+] |