Biotin-5-cytidine-5'-triphosphate lithium salt
Biotin-5-cytidine-5'-triphosphate lithium salt, an imperative entity in the biomedical sector, serves as a pivotal instrument. Its multifarious implementations encompass DNA labeling and sequencing, thus contributing significantly to the realm of biomedicine. This indispensable product facilitates the identification and examination of precise DNA sequences, bolstering research endeavors and providing insights into genetic ailments and conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 85231-47-6 |
| Pricing | Inquire |
| Cas | 85231-47-6 |
| Molecular Weight | 764.53 (free acid) |
| Molecular Formula | C22H35N6O16P3S·xLi |
| Canonical SMILES | C1C2C(C(S1)CCCCC(=O)NCC=CC3=CN(C(=O)N=C3N)C4C(C(C(O4)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)NC(=O)N2 |