(trans-Cinnamoyl)-YPGKF-NH2
| Supplier | Creative Peptides |
|---|---|
| Product # | R0887 |
| CAS # | 327177-34-4 |
| Pricing | Inquire |
| LabelingTarget | Proteinase-activated receptor 4 (PAR4) |
| Synonyms | TCY-NH2 |
| MolecularFormula | C40H49N7O7 |
| MolecularWeight | 739.87 |
| Sequence | YPGKF(Modifications: Tyr-1 = trans-Cinnamoyl-Tyr, Phe-5 = C-terminal amide) |
| Storage | -20°C |
| Explanation | A selective proteinase activated receptor-4 (PAR4) antagonist that inhibits endostatin release and platelet aggregation induced by thrombin. |
| Activity | Antagonist |
| InChI | InChI=1S/C40H49N7O7/c41-22-8-7-14-31(38(52)46-32(37(42)51)24-28-12-5-2-6-13-28)44-36(50)26-43-39(53)34-15-9-23-47(34)40(54)33(25-29-16-19-30(48)20-17-29)45-35(49)21-18-27-10-3-1-4-11-27/h1-6,10-13,16-21,31-34,48H,7-9,14-15,22-26,41H2,(H2,42,51)(H,43,53)(H,44,50)(H,45,49)(H,46,52)/b21-18+/t31-,32-,33-,34-/m0/s1 |
| InChIKey | XKRAKQXQVIGYQC-PHOSSJRVSA-N |
| IsomericSMILES | C1C[C@H](N(C1)C(=O)[C@H](CC2=CC=C(C=C2)O)NC(=O)/C=C/C3=CC=CC=C3)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC4=CC=CC=C4)C(=O)N |
| Purity | >99% |
| LongTermStorageConditions | -20 °C |