5-Methyl-3,4-diphenyl-4,5-dihydroisoxazol-5-ol
An intermediate for the preparation of Valdecoxib. Valdecoxib is a non-steroidal anti-inflammatory drug (NSAID) used for the treatment of osteoarthritis, rheumatoid arthritis, etc. Valdecoxib exhibits a selectively inhibitory effect of cyclooxygenase-2.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2694-053919 |
| Pricing | 200 mg/unit USD $249 |
| Cas | 181696-73-1 |
| Molecular Weight | 253.30 |
| Molecular Formula | C16H15NO2 |
| Canonical SMILES | CC1(C(C(=NO1)C2=CC=CC=C2)C3=CC=CC=C3)O |