Z-Cyclopentyl-AP4
Z-Cyclopentyl-AP4 is a group III mGlu receptor agonist with higher potency at mGlu4 than mGlu8 (EC50 = 49 and 124 μM, respectively). Z-Cyclopentyl-AP4 selectively inhibits synaptic activity in the lateral perforant pathway (IC50 = 130 and 1859 μM in the lateral and medial perforant pathways, respectively).
| Supplier | BOC Sciences |
|---|---|
| Product # | 103439-17-4 |
| Pricing | Inquire |
| Cas | 103439-17-4 |
| Molecular Weight | 209.14 |
| Molecular Formula | C6H12NO5P |
| Canonical SMILES | C1CC(CC1P(=O)(O)O)(C(=O)O)N.C1CC(CC1P(=O)(O)O)(C(=O)O)N |