Silybin A,B (mixture)
Silybin A,B (mixture) is a major flavonolignan found in milk thistle (S. marianum). It exhibits antioxidant activity and is studied as a potential anticancer and chemo-preventive agent. In nature, it occurs as a mixture of two diastereomers, Silybin A and Silybin B.
| Supplier | BOC Sciences |
|---|---|
| Product # | 802918-57-6 |
| Pricing | Inquire |
| Cas | 802918-57-6 |
| Molecular Weight | 482.44 |
| Molecular Formula | C25H22O10 |
| Canonical SMILES | COC1=C(C=CC(=C1)C2C(OC3=C(O2)C=C(C=C3)C4C(C(=O)C5=C(C=C(C=C5O4)O)O)O)CO)O |