4-(Trifluoromethyl)phenylacetic acid
4-(Trifluoromethyl)phenylacetic acid (CAS# 32857-62-8) is an intermediate used to synthesize PPARγ/δ dual agonists via solid-Phase parallel synthesis. It was also used to prepare heterocyclic xanthine derivatives as highly potent and selective human A2B adenosine receptor antagonists.
| Supplier | BOC Sciences |
|---|---|
| Product # | 32857-62-8 |
| Pricing | Inquire |
| Cas | 32857-62-8 |
| Molecular Weight | 204.15 |
| Molecular Formula | C9H7F3O2 |
| Canonical SMILES | C1=CC(=CC=C1CC(=O)O)C(F)(F)F |