Berberine Sulfate Trihydrate
Berberine Sulfate Trihydrate is a potent alkaloid compound widely used in the biomedical industry. Derived from plants, it exhibits antimicrobial and anticancer properties. Berberine Sulfate Trihydrate aids in studying various infections caused by bacteria, fungi and protozoa.
| Supplier | BOC Sciences |
|---|---|
| Product # | 6190-33-6 |
| Pricing | Inquire |
| Cas | 6190-33-6 |
| Molecular Weight | 822.86 |
| Molecular Formula | C40H42N2O15S |
| Canonical SMILES | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.[O-]S(=O)(=O)[O-] |