3'-O-Allylthymidine
3'-O-Allylthymidine, a potent nucleoside analog, possesses impactful antiviral activity against human immunodeficiency virus (HIV) and herpes viruses. Besides being a valuable substrate for biochemical assays that study reverse transcriptase, it also demonstrates promising potential for anticancer therapy.
Supplier | BOC Sciences |
---|---|
Product # | 211191-57-0 |
Pricing | Inquire |
Cas | 211191-57-0 |
Molecular Weight | 282.29 |
Molecular Formula | C13H18N2O5 |
Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)CO)OCC=C |