Oxyresveratrol 3'-O-β-D-glucopyranoside
A derivative of Resveratrol. Resveratrol is a stilbenoid, a type of natural phenol, and a phytoalexin produced by several plants in response to injury or, when the plant is under attack by pathogens such as bacteria or fungi.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1821-483750 |
| Pricing | 5 mg/unit USD $729 |
| Cas | 144525-40-6 |
| Molecular Weight | 406.39 |
| Molecular Formula | C20H22O9 |
| Canonical SMILES | C1=CC(=C(C=C1O)O)C=CC2=CC(=CC(=C2)OC3C(C(C(C(O3)CO)O)O)O)O |