Sch 54292
Sch 54292, a GDP exchange inhibitor, is a cutting-edge biomedical product used in the treatment of certain chronic inflammatory diseases. Its unique formulation has shown promising results in alleviating symptoms and inhibiting disease progression.
| Supplier | BOC Sciences |
|---|---|
| Product # | 188480-51-5 |
| Pricing | Inquire |
| Cas | 188480-51-5 |
| Molecular Weight | 520.55 |
| Molecular Formula | C24H28N2O9S |
| Canonical SMILES | C1=CC=C2C=C(C=CC2=C1)OCCN(C3C(C(C(C(O3)CO)O)O)O)S(=O)(=O)C4=CC=C(C=C4)NO |