4,4'-Diaminodiphenylamine sulfate
4,4'-Diaminodiphenylamine sulfate is a vital compound in the biomedical industry. It is used in the formulation of drugs aimed at treating various diseases, including certain types of cancer. Additionally, it has proven efficacy in targeting specific proteins associated with oxidative stress, showcasing its potential as an antioxidant therapy.
| Supplier | BOC Sciences |
|---|---|
| Product # | 53760-27-3 |
| Pricing | Inquire |
| Cas | 53760-27-3 |
| Molecular Weight | 297.32 |
| Molecular Formula | C12H13N3.H2SO4 |
| Canonical SMILES | C1=CC(=CC=C1N)NC2=CC=C(C=C2)N.OS(=O)(=O)O |