Arbutin-[13C6]
Arbutin-[13C6] is the labelled analogue of Arbutin, a glycosylated hydroquinone that can be extracted from bearberry plant. Arbutin is a known inhibitor of tyrosinase, which in turn prevents the formation of melanin. Arbutin is often used as a skin-lightening agent in cosmetic products.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-011529 |
| Pricing | Inquire |
| Molecular Weight | 278.21 |
| Molecular Formula | C6[13C]6H16O7 |
| Canonical SMILES | C1=CC(=CC=C1O)OC2C(C(C(C(O2)CO)O)O)O |