Propranolol Impurity B
An impurity of Propranolol.Propranolol is Beta 1 adrenergic receptor antagonist. It can be used for the treatment of high blood pressure, a number of types of irregular heart rate, thyrotoxicosis, capillary hemangiomas, performance anxiety, and essential tremors.
| Supplier | BOC Sciences |
|---|---|
| Product # | 83314-78-7 |
| Pricing | Inquire |
| Cas | 83314-78-7 |
| Molecular Weight | 459.58 |
| Molecular Formula | C29H33NO4 |
| Canonical SMILES | CC(C)N(CC(COC1=CC=CC2=CC=CC=C21)O)CC(COC3=CC=CC4=CC=CC=C43)O |