2',3'-Dideoxy-3'-fluoro-a-uridine
2',3'-Dideoxy-3'-fluoro-a-uridine, a pivotal compound employed in the management of HIV and hepatitis B infections, meticulously hampers the duplication of viral RNA, thereby thwarting the rampant proliferation and dissemination of the virus. This potent agent, boasting exceptional antiviral attributes, assumes paramount significance in the realm of biomedical investigation, contributing substantially to the relentless battle against these pernicious viral afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 178374-44-2 |
| Pricing | Inquire |
| Cas | 178374-44-2 |
| Molecular Weight | 230.19 |
| Molecular Formula | C9H11FN2O4 |
| Canonical SMILES | C1C(C(OC1N2C=CC(=O)NC2=O)CO)F |