2-Acetamido-4-O-(2-acetamido-2-deoxy-b-D-glucopyranosyl)-2-deoxy-D-galactopyranose
2-Acetamido-4-O-(2-acetamido-2-deoxy-b-D-glucopyranosyl)-2-deoxy-D-galactopyranose is a pivotal compound in biomedicine, embracing a momentous function as a glycosylated constituent during peptidoglycan synthesis. Its versatile applications encompass the creation of therapeutic agents that combat bacterial infections or dysfunctions arising from compromised peptidoglycan metabolism.
| Supplier | BOC Sciences |
|---|---|
| Product # | 141725-02-2 |
| Pricing | Inquire |
| Cas | 141725-02-2 |
| Molecular Weight | 424.40 |
| Molecular Formula | C16H28N2O11 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1O)CO)OC2C(C(C(C(O2)CO)O)O)NC(=O)C)O |