9-Oxo Epinastine HBr
An impurity of Epinastine. Epinastine is a non-sedating ophthalmic antihistamine that antagonizes histamine H3 receptors and prevents the release of pro-inflammatory mediators from mast cells and eosinophils.
| Supplier | BOC Sciences |
|---|---|
| Product # | 745761-19-7 |
| Pricing | Inquire |
| Cas | 745761-19-7 |
| Molecular Weight | 263.30 80.91 |
| Molecular Formula | C16H13N3O. HBr |
| Canonical SMILES | C1C2C3=CC=CC=C3C(=O)C4=CC=CC=C4N2C(=N1)N |