Hydrocortisone-9,11,12,12-[d4] 21-sulfate sodium salt
Hydrocortisone-9,11,12,12-[d4] 21-sulfate sodium salt is the labelled analogue of Hydrocortisone 21-sulfate sodium salt. Hydrocortisone 21-sulfate sodium salt is a salt of Hydrocortisone. Hydrocortisone is a corticosteroid compound that has a broad range of anti-inflammatory and immunosuppressive effects and thus widely used in therapy of skin wound. Hydrocortisone is also a glucocorticoid produced to increase the level of blood sugar and inhibit the immune system.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-000671 |
| Pricing | Inquire |
| Molecular Weight | 468.53 |
| Molecular Formula | C21H25D4NaO8S |
| Canonical SMILES | CC12CCC(=O)C=C1CCC3C2C(CC4(C3CCC4(C(=O)COS(=O)(=O)[O-])O)C)O.[Na+] |