Larixyl acetate
Larixyl acetate is a potent and selective TRPC6 inhibitor with IC50 values of 0.58 μM and 6.83 μM against hTRPC6-YFP and hTRPC3-YFP, respectively. Larixyl acetate prevents HPV and is effective in protecting against traumatic brain injury-induced systemic endothelial dysfunction.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4608-49-5 |
| Pricing | Inquire |
| Cas | 4608-49-5 |
| Molecular Weight | 348.52 |
| Molecular Formula | C22H36O3 |
| Canonical SMILES | CC(=O)OC1CC(=C)C(C2(C1C(CCC2)(C)C)C)CCC(C)(C=C)OC(=O)C |