1-Tosyl-1,2,3,4-tetrahydrobenzo[b]azepin-5-one
1-Tosyl-1,2,3,4-tetrahydrobenzo[b]azepin-5-one (CAS# 24310-36-9) is an intermediate used to prepare nonpeptide vasopressin V2 receptor antagonist tetrahydro-1H-benzazepines. It is also used to synthesize 4'-[(4,4-difluoro-5-methylidene-2,3,4,5-tetrahydro-1H-1-benzoazepin-1-yl)carbonyl]-2-phenylbenzanilide derivatives as non-peptide arginine vasopressin antagonists for both V1A and V2 receptors.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB018406 |
| Pricing | Inquire |
| Cas | 24310-36-9 |
| Molecular Weight | 315.39 |
| Molecular Formula | C17H17NO3S |
| Canonical SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCCC(=O)C3=CC=CC=C32 |