9(Z),11(E),13(E)-Octadecatrienoic acid methyl ester
9Z,11E,13E-Octadecatrienoic acid (α-ESA) is a conjugated polyunsaturated fatty acid commonly found in plant seed oil. This fatty acid accounts for about 60% of the total fatty acid composition of bitter gourd seed oil and about 70% in tung oil.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4175-47-7 |
| Pricing | Inquire |
| Cas | 4175-47-7 |
| Molecular Weight | 292.5 |
| Molecular Formula | C19H32O2 |
| Canonical SMILES | CCCCC=CC=CC=CCCCCCCCC(=O)OCC |