1-(2'-Deoxy-2'-fluoro--b-D-arabinofuranosyl)-N3-(2S)-[2-(t-butoxycarbonyl)-amino-3-carbonyl]propyluracil
1-(2'-Deoxy-2'-fluoro-β-D-arabinofuranosyl)-N3-(2S)-[2-(t-butoxycarbonyl)-amino-3-carbonyl]propyluracil, widely recognized as a potent antiviral agent within the biomedical field, showcases remarkable proficiency in counteracting viral infections induced by a distinct viral assemblage. This extraordinary compound's efficacy lies in its ability to impede viral replication, rendering it an invaluable asset in the relentless battle against an array of pernicious viral maladies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2072145-73-2 |
| Pricing | Inquire |
| Cas | 2072145-73-2 |
| Molecular Weight | 503.52 |
| Molecular Formula | C22H34FN3O9 |
| Canonical SMILES | CC(C)(C)OC(=O)CC(CN1C(=O)C=CN(C1=O)C2C(C(C(O2)CO)O)F)NC(=O)OC(C)(C)C |