Benzothiazole-7-carboxylic Acid
Benzothiazole-7-carboxylic Acid (CAS# 677304-83-5) is an intermediate used in the synthesis of pyrazole inhibitors of coactivator associated arginine methyltransferase 1 (CARM1). It is also used to prepare aminofuro-pyridine derivatives as inhibitors of TAK1.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB033380 |
| Pricing | Inquire |
| Cas | 677304-83-5 |
| Molecular Weight | 179.20 |
| Molecular Formula | C8H5NO2S |
| Canonical SMILES | C1=CC(=C2C(=C1)N=CS2)C(=O)O |