1-Amino-1-deoxy-D-glucitol hydrochloride
1-Amino-1-deoxy-D-glucitol hydrochloride, an oral hypoglycemic agent, is indicated for the management of diabetes mellitus. The mode of its therapeutic action is multifactorial, involving diminished intestinal glucose absorption and augmented hepatic insulin sensitivity. Notably, this drug exhibits remarkable therapeutic potential in combating diabetic neuropathy as well.
| Supplier | BOC Sciences |
|---|---|
| Product # | 104833-43-4 |
| Pricing | Inquire |
| Cas | 104833-43-4 |
| Molecular Weight | 217.65 |
| Molecular Formula | C6H16ClNO5 |
| Canonical SMILES | C(C(C(C(C(CO)O)O)O)O)N.Cl |