Potassium (tert-Butoxymethyl)trifluoroborate
Potassium (tert-Butoxymethyl)trifluoroborate is a highly versatile and intriguing compound that stands as a prominent figure in the biomedical industry. Its multifaceted nature enables it to serve as a valuable reagent in the intricate synthesis of pharmaceutical compounds. By offering a helping hand in the creation of medicinal field, this product spearheads the quest to combat an array of ailments that plague humanity, ranging from the cancer to inflammation and neurological disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 910251-10-4 |
| Pricing | Inquire |
| Cas | 910251-10-4 |
| Molecular Weight | 194.044 |
| Molecular Formula | C5H11BF3KO |
| Canonical SMILES | [B-](COC(C)(C)C)(F)(F)F.[K+] |