Cephalosporin C Zinc Salt
Cephalosporin C zinc salt is the salt form of cephalosporin C, which is an antibiotic isolated from fungi of the genus Acremonium. Cephalosporin C has weak resistance to gram-positive and negative bacteria, is stable to penicillinase, and can be broken down by cephalosporin enzyme.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1335-029204 |
| Pricing | 1 g/unit USD $187 |
| Cas | 59143-60-1 |
| Molecular Weight | 478.79 |
| Molecular Formula | C16H19N3O8SZn |
| Canonical SMILES | CC(=O)CC1=C(N2C(C(C2=O)NC(=O)CCCC(C(=O)[O-])N)SC1)C(=O)[O-].[Zn+2] |