2-[(4'-Chloro-1-naphthyloxy)methyl]phenylboronic acid
2-[(4'-Chloro-1-naphthyloxy)methyl]phenylboronic acid is a boronic acid derivative used in biomedical research. Its primary application lies in the synthesis of pharmaceuticals targeting cardiovascular diseases and various forms of cancer, enhancing drug efficiency and specificity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1072951-65-5 |
| Pricing | Inquire |
| Cas | 1072951-65-5 |
| Molecular Weight | 312.6 |
| Molecular Formula | C17H14BClO3 |
| Canonical SMILES | B(C1=CC=CC=C1COC2=CC=C(C3=CC=CC=C32)Cl)(O)O |