18:1 Biotinyl PE (sodium salt)
A compound known as 18:1 Biotinyl PE (sodium salt), this biotinylated phosphatidylethanolamine features a C18:1 acyl chain. Widely utilized in the biomedical sector to investigate lipid metabolism and membrane dynamics, it also plays a crucial role in drug delivery systems tailored for precise disease targeting, notably cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 384835-53-4 |
| Pricing | Inquire |
| Cas | 384835-53-4 |
| Molecular Weight | 992.31 |
| Molecular Formula | C51H91N3O10PNaS |
| Canonical SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)([O-])OCCNC(=O)CCCCC1C2C(CS1)NC(=O)N2)OC(=O)CCCCCCCC=CCCCCCCCC.[Na+] |