hexyl D-glucoside
Hexyl D-glucoside is an extensively employed solubilization compound and detergent in drug formulations and research. Its proficiency in augmenting the solubility of hydrophobic drug entities renders it a quintessential constituent within diverse pharmaceutical arenas.
| Supplier | BOC Sciences |
|---|---|
| Product # | 54549-24-5 |
| Pricing | Inquire |
| Cas | 54549-24-5 |
| Molecular Weight | 264.31 |
| Molecular Formula | C12H24O6 |
| Canonical SMILES | CCCCCCOC1C(C(C(C(O1)CO)O)O)O |