15(R)-17-phenyl trinor Prostaglandin F2α isopropyl ester
15(R)-17-phenyl trinor Prostaglandin F2α isopropyl ester is a potential impurity in most commercial preparations of the latanoprost bulk drug product. The IC50 value for the free acid forms of 15(R)-17-phenyl trinor PGF2α wa determined to be 30 nM in a FP receptor binding assay using the cat iris sphincter muscle.
| Supplier | BOC Sciences |
|---|---|
| Product # | 130273-87-9 |
| Pricing | Inquire |
| Cas | 130273-87-9 |
| Molecular Weight | 430.59 |
| Molecular Formula | C26H38O5 |
| Canonical SMILES | CC(C)OC(=O)CCCC=CCC1C(CC(C1C=CC(CCC2=CC=CC=C2)O)O)O |