A-25822 N
A-25822 N is an azasteroid antibiotic produced by Geotrichum flavobrienneum. It has anti-fungal activity, and the MIC for fungi such as Candida albicans, Cryptococcus neoformans, Trichophyton mentacea, Phytoplastria, Saccharomyces cerevisiae, Saccharomyces cerevisiae, Microsporum, etc. is 0.321-1.25 μg/mL. Antibacterial activity is weak.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-03136 |
| Pricing | Inquire |
| Cas | 50687-00-8 |
| Molecular Weight | 409.65 |
| Molecular Formula | C28H43NO |
| Canonical SMILES | CC(C)C(=C)CCC(C)C1CCN=C2C1(CCC3=C2CCC4C3(CCC(=O)C4)C)C |