Oleyl dihydrogen phosphate
Oleyl dihydrogen phosphate is a compound used in biomedicine as a vehicle for drug delivery due to its ability to penetrate cell membranes. It has potential applications in targeted drug delivery for the treatment of certain cancers and neurological disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 7722-71-6 |
| Pricing | Inquire |
| Cas | 7722-71-6 |
| Molecular Weight | 348.46 |
| Molecular Formula | C18H37O4P |
| Canonical SMILES | CCCCCCCCC=CCCCCCCCCOP(=O)(O)O |