Nampt-IN-1
Nampt-IN-1, a pyridyloxyacetyl tetrahydroisoquinoline compound, is a novel inhibitor of nicotinamide phosphoribosyltransferase (NAMPT) with the potential to treat cancer.
IC50: NCI-H1155 cell= 18 nM, Calu-6 cell= 49 nM, HCC1937 cell= 333 nM, MCF-7 cell= 3
IC50: NCI-H1155 cell= 18 nM, Calu-6 cell= 49 nM, HCC1937 cell= 333 nM, MCF-7 cell= 3
| Supplier | BOC Sciences |
|---|---|
| Product # | 1698878-14-6 |
| Pricing | Inquire |
| Cas | 1698878-14-6 |
| Molecular Weight | 419.49 |
| Molecular Formula | C20H25N3O5S |
| Canonical SMILES | CC(C)(CS(=O)(=O)NC1=CC2=C(CN(CC2)C(=O)COC3=CN=CC=C3)C=C1)O |