7-Epiclindamycin hydrochloride
7-Epiclindamycin hydrochloride, a highly efficacious antibiotic, exhibits remarkable efficacy against a wide range of bacterial infections. By discerningly impeding protein synthesis within bacterial organisms, it disrupts their growth and obstructs their survival, effectively eliminating the pernicious microorganisms. Distinctively versatile, this compound demonstrates its unwavering effectiveness against both Gram-positive and Gram-negative bacteria. Consequently, this invaluable asset plays an integral role in the biomedical field, diligently combatting infectious ailments with exceptional efficacy.
| Supplier | BOC Sciences |
|---|---|
| Product # | 17431-55-9 |
| Pricing | Inquire |
| Cas | 17431-55-9 |
| Molecular Weight | 461.45 |
| Molecular Formula | C18H33ClN2O5S.HCl |
| Canonical SMILES | CCCC1CC(N(C1)C)C(=O)NC(C2C(C(C(C(O2)SC)O)O)O)C(C)Cl.Cl |