(2S- cis) -1- Acetyl- 4- [4- [[2- (bromomethyl) - 2- (2, 4- dichlorophenyl) - 1, 3- dioxolan- 4- yl] methoxy] phenyl] -piperazine
(2S- cis) -1- Acetyl- 4- [4- [[2- (bromomethyl) - 2- (2, 4- dichlorophenyl) - 1, 3- dioxolan- 4- yl] methoxy] phenyl] -piperazine is a related compound of Ketoconazole (CAT# K186000), which is used in the treatement of fungal infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB060492 |
| Pricing | Inquire |
| Cas | 142128-65-2 |
| Molecular Weight | 544.27 |
| Molecular Formula | C23H25BrCl2N2O4 |
| Canonical SMILES | CC(=O)N1CCN(CC1)C2=CC=C(C=C2)OCC3COC(O3)(CBr)C4=C(C=C(C=C4)Cl)Cl |