Menadione sodium bisulfite
Menadione sodium bisulfite is a water-soluble form of menadione, which belongs to the Vitamin K class of compounds. It is a possible anticancer agent able to induce apoptosis. It can be used for bleeding caused by vitamin K deficiency.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-03817 |
| Pricing | Inquire |
| Cas | 130-37-0 |
| Molecular Weight | 276.24 |
| Molecular Formula | C11H9NaO5S |
| Canonical SMILES | CC1(CC(=O)C2=CC=CC=C2C1=O)S(=O)(=O)[O-].[Na+] |