Potassium cyclohexenyltrifluoroborate
Potassium benzothiophene-3-trifluoroborate is a vital component in the biomedical industry, utilized for the development of pharmaceutical drugs targeting various diseases. This compound plays a crucial role in the synthesis of novel therapeutic agents designed to treat conditions like cancer, inflammation, and infectious diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1186667-20-8 |
| Pricing | Inquire |
| Cas | 1186667-20-8 |
| Molecular Weight | 188.04 |
| Molecular Formula | C6H9BF3K |
| Canonical SMILES | [B-](C1=CCCCC1)(F)(F)F.[K+] |