Adenylyl-(3'-5')-adenosine monoammonia salt
Adenylyl-(3'-5')-adenosine monoammonia salt is a vital compound utilized in biomedical research. It is commonly employed for studying intracellular signaling pathways and second messengers, including cAMP (cyclic adenosine monophosphate). This product plays a crucial role in investigating the activation and regulation of various enzymes, receptors, and ion channels involved in multiple diseases, such as cancer, cardiovascular disorders, and neurological conditions. Its high purity and quality ensure accurate and reliable experimental results.
| Supplier | BOC Sciences |
|---|---|
| Product # | 102029-96-9 |
| Pricing | Inquire |
| Cas | 102029-96-9 |
| Molecular Weight | 613.48 |
| Molecular Formula | C20H25N10O10P.NH3 |
| Canonical SMILES | C1=NC2=C(C(=N1)N)N=CN2C3C(C(C(O3)COP(=O)(O)OC4C(OC(C4O)N5C=NC6=C5N=CN=C6N)CO)O)O |