Fmoc-D-valine
N-Fmoc-D-valine is an N-Fmoc-protected form of D-Valine. D-Valine exhibited inhibitory effects on fibroblasts that is contaminated mammalian kidney cultures, allowing for selective growth epithelial cells. D-Valine is also known for its presence in the structure of Actinomycin D, an antitumour drug. D-Valine is naturally synthesized by Streptomyces antibioticus.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-003725 |
| Pricing | Inquire |
| Cas | 84624-17-9 |
| Molecular Weight | 339.40 |
| Molecular Formula | C20H21NO4 |
| Canonical SMILES | CC(C)C(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |