D-Cellobiose
D-Cellobiose, an imperative disaccharide formed by coupling two glucose molecules, finds extensive utility in the biomedical sector. This compound assumes the role of a crucial substrate in enzyme assays, thereby facilitating their efficacy. Moreover, it serves as a vital carbon source for bacteria engrossed in the degradation of cellulose.
| Supplier | BOC Sciences |
|---|---|
| Product # | 528-50-7 |
| Pricing | Inquire |
| Cas | 528-50-7 |
| Molecular Weight | 342.30 |
| Molecular Formula | C12H22O11 |
| Canonical SMILES | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O |