2'-Deoxyadenylyl-(3'-5')-2'-deoxyadenosine
2'-Deoxyadenylyl-(3'-5')-2'-deoxyadenosine, a critical intermediate in nucleic acid synthesis and repair, is known for its pivotal role in repairing damaged DNA caused by cancer chemotherapeutic drugs by reversing DNA chain breaks via enzymatic utilization. This compound's potential as a treatment for DNA damage-associated diseases has also been subject to considerable scientific scrutiny.
| Supplier | BOC Sciences |
|---|---|
| Product # | 23339-45-9 |
| Pricing | Inquire |
| Cas | 23339-45-9 |
| Molecular Weight | 564.50 |
| Molecular Formula | C20H25N10O8P |
| Canonical SMILES | C1C(C(OC1N2C=NC3=C(N=CN=C32)N)COP(=O)(O)OC4CC(OC4CO)N5C=NC6=C(N=CN=C65)N)O |