Norhyoscyamine sulfate
Norhyoscyamine sulfate, a potent anticholinergic agent, exerts its therapeutic effects through the inhibition of acetylcholine activity, which makes it a valuable treatment option for several types of gastrointestinal disorders, such as motility disorders, as well as urinary incontinence. Moreover, this multifaceted medication exhibits remarkable preoperative benefits, as it can effectively reduce both respiratory and digestive secretions, underscoring its versatility and potential for widespread clinical use.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1370-152647 |
| Pricing | Inquire |
| Cas | 537-29-1 |
| Molecular Weight | 275.34 |
| Molecular Formula | C16H21NO3 |
| Canonical SMILES | C1CC2CC(CC1N2)OC(=O)C(CO)C3=CC=CC=C3 |